C18H17ClN2O2 — CID 91683703
2-chloro-N-[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]acetamide (PubChem CID 91683703) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-chloro-N-[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]acetamide.
| Compound Name | 2-chloro-N-[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 91683703 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-chloro-N-[5-(5,6-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]acetamide |
| SMILES | Cc1cc2nc(-c3ccc(C)c(NC(=O)CCl)c3)oc2cc1C |
| InChI | InChI=1S/C18H17ClN2O2/c1-10-4-5-13(8-14(10)20-17(22)9-19)18-21-15-6-11(2)12(3)7-16(15)23-18/h4-8H,9H2,1-3H3,(H,20,22) |
| InChIKey | DBKCSWJRSWNBNF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|