C17H14BrClN2O2 — CID 91683717
N-[2-bromo-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-chloroacetamide (PubChem CID 91683717) has the molecular formula C17H14BrClN2O2 and a molecular weight of 393.67 g/mol. Its IUPAC name is N-[2-bromo-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-chloroacetamide.
| Compound Name | N-[2-bromo-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 91683717 |
| Molecular Formula | C17H14BrClN2O2 |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | N-[2-bromo-5-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-chloroacetamide |
| SMILES | CCc1ccc2oc(-c3ccc(Br)c(NC(=O)CCl)c3)nc2c1 |
| InChI | InChI=1S/C17H14BrClN2O2/c1-2-10-3-6-15-14(7-10)21-17(23-15)11-4-5-12(18)13(8-11)20-16(22)9-19/h3-8H,2,9H2,1H3,(H,20,22) |
| InChIKey | CUSSBYBLSATONX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|