C14H18ClN3O2S — CID 4635791
4-chloro-N-[4-(propanoylcarbamothioylamino)phenyl]butanamide (PubChem CID 4635791) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is 4-chloro-N-[4-(propanoylcarbamothioylamino)phenyl]butanamide.
| Compound Name | 4-chloro-N-[4-(propanoylcarbamothioylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 4635791 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-chloro-N-[4-(propanoylcarbamothioylamino)phenyl]butanamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(NC(=O)CCCCl)cc1 |
| InChI | InChI=1S/C14H18ClN3O2S/c1-2-12(19)18-14(21)17-11-7-5-10(6-8-11)16-13(20)4-3-9-15/h5-8H,2-4,9H2,1H3,(H,16,20)(H2,17,18,19,21) |
| InChIKey | KTKLGJQUHSWWBN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|