C12H17N3OS — CID 823780
N-[[4-(dimethylamino)phenyl]carbamothioyl]propanamide (PubChem CID 823780) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]carbamothioyl]propanamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 823780 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]carbamothioyl]propanamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C12H17N3OS/c1-4-11(16)14-12(17)13-9-5-7-10(8-6-9)15(2)3/h5-8H,4H2,1-3H3,(H2,13,14,16,17) |
| InChIKey | ZSRGGTRXLNHVSK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|