C25H24N4O2S2 — CID 4634604
N-[[4-[(2,2-diphenylacetyl)carbamothioylamino]phenyl]carbamothioyl]propanamide (PubChem CID 4634604) has the molecular formula C25H24N4O2S2 and a molecular weight of 476.63 g/mol. Its IUPAC name is N-[[4-[(2,2-diphenylacetyl)carbamothioylamino]phenyl]carbamothioyl]propanamide.
| Compound Name | N-[[4-[(2,2-diphenylacetyl)carbamothioylamino]phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 4634604 |
| Molecular Formula | C25H24N4O2S2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[[4-[(2,2-diphenylacetyl)carbamothioylamino]phenyl]carbamothioyl]propanamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N4O2S2/c1-2-21(30)28-24(32)26-19-13-15-20(16-14-19)27-25(33)29-23(31)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-16,22H,2H2,1H3,(H2,26,28,30,32)(H2,27,29,31,33) |
| InChIKey | BMFXJNJXISMLAQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|