C21H18N2O2S — CID 4630986
N-[(4-hydroxyphenyl)carbamothioyl]-2,2-diphenylacetamide (PubChem CID 4630986) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[(4-hydroxyphenyl)carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4630986 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[(4-hydroxyphenyl)carbamothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)Nc1ccc(O)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2S/c24-18-13-11-17(12-14-18)22-21(26)23-20(25)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,19,24H,(H2,22,23,25,26) |
| InChIKey | HGQBZRISOBNTOY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|