C21H17FN2OS — CID 1048111
N-[(4-fluorophenyl)carbamothioyl]-2,2-diphenylacetamide (PubChem CID 1048111) has the molecular formula C21H17FN2OS and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[(4-fluorophenyl)carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 1048111 |
| Molecular Formula | C21H17FN2OS |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[(4-fluorophenyl)carbamothioyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(=S)Nc1ccc(F)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17FN2OS/c22-17-11-13-18(14-12-17)23-21(26)24-20(25)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,19H,(H2,23,24,25,26) |
| InChIKey | JVFGLTCKJSHKOM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|