C29H27N3O3S2 — CID 4631515
N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2,2-diphenylacetamide (PubChem CID 4631515) has the molecular formula C29H27N3O3S2 and a molecular weight of 529.69 g/mol. Its IUPAC name is N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2,2-diphenylacetamide.
| Compound Name | N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4631515 |
| Molecular Formula | C29H27N3O3S2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2,2-diphenylacetamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C(c3ccccc3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C29H27N3O3S2/c1-20-17-21(2)19-25(18-20)32-37(34,35)26-15-13-24(14-16-26)30-29(36)31-28(33)27(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-19,27,32H,1-2H3,(H2,30,31,33,36) |
| InChIKey | WTTLIACSLNDFMX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|