C20H20N2O4S2 — CID 3385972
4-(benzenesulfonamido)-N-(3,5-dimethylphenyl)benzenesulfonamide (PubChem CID 3385972) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-(3,5-dimethylphenyl)benzenesulfonamide.
| Compound Name | 4-(benzenesulfonamido)-N-(3,5-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3385972 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-(benzenesulfonamido)-N-(3,5-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-15-12-16(2)14-18(13-15)22-28(25,26)20-10-8-17(9-11-20)21-27(23,24)19-6-4-3-5-7-19/h3-14,21-22H,1-2H3 |
| InChIKey | VKBLJCLYIOHNIL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |