C20H18BrNO3S — CID 25035913
4-(4-bromophenoxy)-N-(3,5-dimethylphenyl)benzenesulfonamide (PubChem CID 25035913) has the molecular formula C20H18BrNO3S and a molecular weight of 432.34 g/mol. Its IUPAC name is 4-(4-bromophenoxy)-N-(3,5-dimethylphenyl)benzenesulfonamide.
| Compound Name | 4-(4-bromophenoxy)-N-(3,5-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 25035913 |
| Molecular Formula | C20H18BrNO3S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 4-(4-bromophenoxy)-N-(3,5-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(Oc3ccc(Br)cc3)cc2)c1 |
| InChI | InChI=1S/C20H18BrNO3S/c1-14-11-15(2)13-17(12-14)22-26(23,24)20-9-7-19(8-10-20)25-18-5-3-16(21)4-6-18/h3-13,22H,1-2H3 |
| InChIKey | YDFOOPNSZLZPDX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |