C21H21NO3S — CID 1377807
N-[4-(3,4-dimethylphenoxy)phenyl]-4-methylbenzenesulfonamide (PubChem CID 1377807) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenoxy)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-(3,4-dimethylphenoxy)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1377807 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[4-(3,4-dimethylphenoxy)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Oc3ccc(C)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-15-4-12-21(13-5-15)26(23,24)22-18-7-10-19(11-8-18)25-20-9-6-16(2)17(3)14-20/h4-14,22H,1-3H3 |
| InChIKey | QYSFOQQDEXZCBV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |