C18H17NO2S — CID 874153
N-(3,5-dimethylphenyl)naphthalene-2-sulfonamide (PubChem CID 874153) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)naphthalene-2-sulfonamide.
| Compound Name | N-(3,5-dimethylphenyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 874153 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-(3,5-dimethylphenyl)naphthalene-2-sulfonamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C18H17NO2S/c1-13-9-14(2)11-17(10-13)19-22(20,21)18-8-7-15-5-3-4-6-16(15)12-18/h3-12,19H,1-2H3 |
| InChIKey | ZSDJLKZEGCZDGX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |