C17H16N2O4S2 — CID 86922484
1-N-methyl-4-N-naphthalen-2-ylbenzene-1,4-disulfonamide (PubChem CID 86922484) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-N-methyl-4-N-naphthalen-2-ylbenzene-1,4-disulfonamide.
| Compound Name | 1-N-methyl-4-N-naphthalen-2-ylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 86922484 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-N-methyl-4-N-naphthalen-2-ylbenzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)Nc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C17H16N2O4S2/c1-18-24(20,21)16-8-10-17(11-9-16)25(22,23)19-15-7-6-13-4-2-3-5-14(13)12-15/h2-12,18-19H,1H3 |
| InChIKey | OEGUDLSVNOVSQY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |