C15H18N2O4S2 — CID 46555814
4-N-(3,4-dimethylphenyl)-1-N-methylbenzene-1,4-disulfonamide (PubChem CID 46555814) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-N-(3,4-dimethylphenyl)-1-N-methylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-(3,4-dimethylphenyl)-1-N-methylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 46555814 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 4-N-(3,4-dimethylphenyl)-1-N-methylbenzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(S(=O)(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C15H18N2O4S2/c1-11-4-5-13(10-12(11)2)17-23(20,21)15-8-6-14(7-9-15)22(18,19)16-3/h4-10,16-17H,1-3H3 |
| InChIKey | WFKASAJURPTSBG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |