C22H23N3O5S2 — CID 31307957
N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(methylsulfamoyl)benzamide (PubChem CID 31307957) has the molecular formula C22H23N3O5S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(methylsulfamoyl)benzamide.
| Compound Name | N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 31307957 |
| Molecular Formula | C22H23N3O5S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)Nc2ccc(S(=O)(=O)Nc3ccc(C)c(C)c3)cc2)c1 |
| InChI | InChI=1S/C22H23N3O5S2/c1-15-7-8-19(13-16(15)2)25-32(29,30)20-11-9-18(10-12-20)24-22(26)17-5-4-6-21(14-17)31(27,28)23-3/h4-14,23,25H,1-3H3,(H,24,26) |
| InChIKey | GWNILRGMHPPFEO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |