C17H20N2O4S2 — CID 35506541
1-N-cyclopropyl-4-N-(3,4-dimethylphenyl)benzene-1,4-disulfonamide (PubChem CID 35506541) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-N-cyclopropyl-4-N-(3,4-dimethylphenyl)benzene-1,4-disulfonamide.
| Compound Name | 1-N-cyclopropyl-4-N-(3,4-dimethylphenyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 35506541 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-N-cyclopropyl-4-N-(3,4-dimethylphenyl)benzene-1,4-disulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)cc1C |
| InChI | InChI=1S/C17H20N2O4S2/c1-12-3-4-15(11-13(12)2)19-25(22,23)17-9-7-16(8-10-17)24(20,21)18-14-5-6-14/h3-4,7-11,14,18-19H,5-6H2,1-2H3 |
| InChIKey | LHRZBQWJXIQBNV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |