C15H22N2O3S — CID 123780461
4-[(3,4-dimethylphenyl)sulfonylamino]cyclohexane-1-carboxamide (PubChem CID 123780461) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)sulfonylamino]cyclohexane-1-carboxamide.
| Compound Name | 4-[(3,4-dimethylphenyl)sulfonylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123780461 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)sulfonylamino]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCC(C(N)=O)CC2)cc1C |
| InChI | InChI=1S/C15H22N2O3S/c1-10-3-8-14(9-11(10)2)21(19,20)17-13-6-4-12(5-7-13)15(16)18/h3,8-9,12-13,17H,4-7H2,1-2H3,(H2,16,18) |
| InChIKey | MOJUJYDYOZYYGB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |