C14H20N4O3S — CID 138723570
2-(1-aminoethylideneamino)-N-[5-(cyclopropylsulfamoyl)-2-methylphenyl]acetamide (PubChem CID 138723570) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-(1-aminoethylideneamino)-N-[5-(cyclopropylsulfamoyl)-2-methylphenyl]acetamide.
| Compound Name | 2-(1-aminoethylideneamino)-N-[5-(cyclopropylsulfamoyl)-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 138723570 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(1-aminoethylideneamino)-N-[5-(cyclopropylsulfamoyl)-2-methylphenyl]acetamide |
| SMILES | C/C(N)=N\CC(=O)Nc1cc(S(=O)(=O)NC2CC2)ccc1C |
| InChI | InChI=1S/C14H20N4O3S/c1-9-3-6-12(22(20,21)18-11-4-5-11)7-13(9)17-14(19)8-16-10(2)15/h3,6-7,11,18H,4-5,8H2,1-2H3,(H2,15,16)(H,17,19) |
| InChIKey | RYUDWFZROHEHEJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|