C11H15ClN4O3S — CID 61051961
4-[(2-chloropyrimidin-5-yl)sulfonylamino]cyclohexane-1-carboxamide (PubChem CID 61051961) has the molecular formula C11H15ClN4O3S and a molecular weight of 318.79 g/mol. Its IUPAC name is 4-[(2-chloropyrimidin-5-yl)sulfonylamino]cyclohexane-1-carboxamide.
| Compound Name | 4-[(2-chloropyrimidin-5-yl)sulfonylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 61051961 |
| Molecular Formula | C11H15ClN4O3S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-[(2-chloropyrimidin-5-yl)sulfonylamino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(NS(=O)(=O)c2cnc(Cl)nc2)CC1 |
| InChI | InChI=1S/C11H15ClN4O3S/c12-11-14-5-9(6-15-11)20(18,19)16-8-3-1-7(2-4-8)10(13)17/h5-8,16H,1-4H2,(H2,13,17) |
| InChIKey | SBULJQOVQZJWDZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |