C16H16Cl2N2O4S — CID 90786256
4-[(1,4-dichloroisoquinolin-7-yl)sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 90786256) has the molecular formula C16H16Cl2N2O4S and a molecular weight of 403.29 g/mol. Its IUPAC name is 4-[(1,4-dichloroisoquinolin-7-yl)sulfonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1,4-dichloroisoquinolin-7-yl)sulfonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 90786256 |
| Molecular Formula | C16H16Cl2N2O4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 4-[(1,4-dichloroisoquinolin-7-yl)sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NS(=O)(=O)c2ccc3c(Cl)cnc(Cl)c3c2)CC1 |
| InChI | InChI=1S/C16H16Cl2N2O4S/c17-14-8-19-15(18)13-7-11(5-6-12(13)14)25(23,24)20-10-3-1-9(2-4-10)16(21)22/h5-10,20H,1-4H2,(H,21,22) |
| InChIKey | WAVDJDKQAGCXAH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|