C13H14ClF2NO4S — CID 122071127
4-[(6-chloro-2,3-difluorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 122071127) has the molecular formula C13H14ClF2NO4S and a molecular weight of 353.77 g/mol. Its IUPAC name is 4-[(6-chloro-2,3-difluorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(6-chloro-2,3-difluorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122071127 |
| Molecular Formula | C13H14ClF2NO4S |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 4-[(6-chloro-2,3-difluorophenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NS(=O)(=O)c2c(Cl)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C13H14ClF2NO4S/c14-9-5-6-10(15)11(16)12(9)22(20,21)17-8-3-1-7(2-4-8)13(18)19/h5-8,17H,1-4H2,(H,18,19) |
| InChIKey | TYTWKJXQLTYEDS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|