C16H22ClNO4S — CID 120968698
4-[(2-chloro-5-propan-2-ylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 120968698) has the molecular formula C16H22ClNO4S and a molecular weight of 359.88 g/mol. Its IUPAC name is 4-[(2-chloro-5-propan-2-ylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-chloro-5-propan-2-ylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120968698 |
| Molecular Formula | C16H22ClNO4S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-[(2-chloro-5-propan-2-ylphenyl)sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)c1ccc(Cl)c(S(=O)(=O)NC2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C16H22ClNO4S/c1-10(2)12-5-8-14(17)15(9-12)23(21,22)18-13-6-3-11(4-7-13)16(19)20/h5,8-11,13,18H,3-4,6-7H2,1-2H3,(H,19,20) |
| InChIKey | DZABXMMWLSPMDU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |