C13H15Cl2NO4S — CID 46574592
propan-2-yl 2,4-dichloro-5-(cyclopropylsulfamoyl)benzoate (PubChem CID 46574592) has the molecular formula C13H15Cl2NO4S and a molecular weight of 352.24 g/mol. Its IUPAC name is propan-2-yl 2,4-dichloro-5-(cyclopropylsulfamoyl)benzoate.
| Compound Name | propan-2-yl 2,4-dichloro-5-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46574592 |
| Molecular Formula | C13H15Cl2NO4S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | propan-2-yl 2,4-dichloro-5-(cyclopropylsulfamoyl)benzoate |
| SMILES | CC(C)OC(=O)c1cc(S(=O)(=O)NC2CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO4S/c1-7(2)20-13(17)9-5-12(11(15)6-10(9)14)21(18,19)16-8-3-4-8/h5-8,16H,3-4H2,1-2H3 |
| InChIKey | JWCABJOPFGGEDQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |