C17H22Cl2N2O3S — CID 19257581
2,4-dichloro-N-cyclohexyl-5-(cyclopropylsulfamoyl)-N-methylbenzamide (PubChem CID 19257581) has the molecular formula C17H22Cl2N2O3S and a molecular weight of 405.35 g/mol. Its IUPAC name is 2,4-dichloro-N-cyclohexyl-5-(cyclopropylsulfamoyl)-N-methylbenzamide.
| Compound Name | 2,4-dichloro-N-cyclohexyl-5-(cyclopropylsulfamoyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 19257581 |
| Molecular Formula | C17H22Cl2N2O3S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2,4-dichloro-N-cyclohexyl-5-(cyclopropylsulfamoyl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(S(=O)(=O)NC2CC2)c(Cl)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C17H22Cl2N2O3S/c1-21(12-5-3-2-4-6-12)17(22)13-9-16(15(19)10-14(13)18)25(23,24)20-11-7-8-11/h9-12,20H,2-8H2,1H3 |
| InChIKey | PBNPOMLBGHDXND-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |