About propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate
propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate (PubChem CID 56543666) has the molecular formula C15H18Cl2N2O5S
and a molecular weight of 409.29 g/mol. Its IUPAC name is propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate |
| PubChem CID | 56543666 |
| Molecular Formula | C15H18Cl2N2O5S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CC(C)OC(=O)CNC(=O)c1cc(S(=O)(=O)NC2CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O5S/c1-8(2)24-14(20)7-18-15(21)10-5-13(12(17)6-11(10)16)25(22,23)19-9-3-4-9/h5-6,8-9,19H,3-4,7H2,1-2H3,(H,18,21) |
| InChIKey | NTNKFWONMAHIQB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate?
The IUPAC name of propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate (CID 56543666) is propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate.
What is the SMILES notation for propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate?
The canonical SMILES for propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate is CC(C)OC(=O)CNC(=O)c1cc(S(=O)(=O)NC2CC2)c(Cl)cc1Cl.
What is the InChIKey of propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate?
The InChIKey is NTNKFWONMAHIQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18Cl2N2O5S/c1-8(2)24-14(20)7-18-15(21)10-5-13(12(17)6-11(10)16)25(22,23)19-9-3-4-9/h5-6,8-9,19H,3-4,7H2,1-2H3,(H,18,21).
What are the key properties of propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate?
propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate has a molecular weight of 409.29 g/mol, XLogP of 2.12, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[[2,4-dichloro-5-(cyclopropylsulfamoyl)benzoyl]amino]acetate is sourced from PubChem (CID 56543666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).