C16H23Cl2N3O3S — CID 19257534
2,4-dichloro-5-(cyclopropylsulfamoyl)-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 19257534) has the molecular formula C16H23Cl2N3O3S and a molecular weight of 408.35 g/mol. Its IUPAC name is 2,4-dichloro-5-(cyclopropylsulfamoyl)-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 2,4-dichloro-5-(cyclopropylsulfamoyl)-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 19257534 |
| Molecular Formula | C16H23Cl2N3O3S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2,4-dichloro-5-(cyclopropylsulfamoyl)-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(S(=O)(=O)NC2CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H23Cl2N3O3S/c1-3-21(4-2)8-7-19-16(22)12-9-15(14(18)10-13(12)17)25(23,24)20-11-5-6-11/h9-11,20H,3-8H2,1-2H3,(H,19,22) |
| InChIKey | OAVLZMGOISXHAB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |