C18H24Cl2N2O4S — CID 2336712
2,4-dichloro-N-cyclohexyl-N-methyl-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 2336712) has the molecular formula C18H24Cl2N2O4S and a molecular weight of 435.37 g/mol. Its IUPAC name is 2,4-dichloro-N-cyclohexyl-N-methyl-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-cyclohexyl-N-methyl-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2336712 |
| Molecular Formula | C18H24Cl2N2O4S |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2,4-dichloro-N-cyclohexyl-N-methyl-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CN(C(=O)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C18H24Cl2N2O4S/c1-21(13-5-3-2-4-6-13)18(23)14-11-17(16(20)12-15(14)19)27(24,25)22-7-9-26-10-8-22/h11-13H,2-10H2,1H3 |
| InChIKey | XGVHNQSFWKNUIV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |