C15H19Cl2NO5S — CID 24518178
2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 24518178) has the molecular formula C15H19Cl2NO5S and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 24518178 |
| Molecular Formula | C15H19Cl2NO5S |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | CC(C)COC(=O)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2NO5S/c1-10(2)9-23-15(19)11-7-14(13(17)8-12(11)16)24(20,21)18-3-5-22-6-4-18/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | YHRCFNLVBHXQSQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |