2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate

C15H19Cl2NO5S — CID 24518178

IUPAC2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate
SMILESCC(C)COC(=O)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl
InChIInChI=1S/C15H19Cl2NO5S/c1-10(2)9-23-15(19)11-7-14(13(17)8-12(11)16)24(20,21)18-3-5-22-6-4-18/h7-8,10H,3-6,9H2,1-2H3
InChIKeyYHRCFNLVBHXQSQ-UHFFFAOYSA-N
MW396.29 g/mol
LogP2.83
Rot. Bonds5

About 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate

2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 24518178) has the molecular formula C15H19Cl2NO5S and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate.

Molecular Properties

Compound Name2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate
PubChem CID24518178
Molecular FormulaC15H19Cl2NO5S
Molecular Weight396.29 g/mol
Exact Mass395.04
IUPAC Name2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate
SMILESCC(C)COC(=O)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl
InChIInChI=1S/C15H19Cl2NO5S/c1-10(2)9-23-15(19)11-7-14(13(17)8-12(11)16)24(20,21)18-3-5-22-6-4-18/h7-8,10H,3-6,9H2,1-2H3
InChIKeyYHRCFNLVBHXQSQ-UHFFFAOYSA-N
XLogP2.83
TPSA72.91 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500396.29
LogP ≤ 52.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate?
The IUPAC name of 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate (CID 24518178) is 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate.
What is the SMILES notation for 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate?
The canonical SMILES for 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate is CC(C)COC(=O)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl.
What is the InChIKey of 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate?
The InChIKey is YHRCFNLVBHXQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2NO5S/c1-10(2)9-23-15(19)11-7-14(13(17)8-12(11)16)24(20,21)18-3-5-22-6-4-18/h7-8,10H,3-6,9H2,1-2H3.
What are the key properties of 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate?
2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate has a molecular weight of 396.29 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate is sourced from PubChem (CID 24518178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).