C13H15Cl2NO6S — CID 24518137
2-hydroxyethyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 24518137) has the molecular formula C13H15Cl2NO6S and a molecular weight of 384.24 g/mol. Its IUPAC name is 2-hydroxyethyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | 2-hydroxyethyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 24518137 |
| Molecular Formula | C13H15Cl2NO6S |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 2-hydroxyethyl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCCO)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO6S/c14-10-8-11(15)12(7-9(10)13(18)22-6-3-17)23(19,20)16-1-4-21-5-2-16/h7-8,17H,1-6H2 |
| InChIKey | JBHCOOUKYJALNJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |