C14H17Cl2NO5S — CID 43004454
propan-2-yl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 43004454) has the molecular formula C14H17Cl2NO5S and a molecular weight of 382.27 g/mol. Its IUPAC name is propan-2-yl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | propan-2-yl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 43004454 |
| Molecular Formula | C14H17Cl2NO5S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | propan-2-yl 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | CC(C)OC(=O)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NO5S/c1-9(2)22-14(18)10-7-13(12(16)8-11(10)15)23(19,20)17-3-5-21-6-4-17/h7-9H,3-6H2,1-2H3 |
| InChIKey | OTKCRCFYOVYJSS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |