C21H31Cl2N3O4S — CID 55724763
2,4-dichloro-N-[4-(4-methylpiperidin-1-yl)butyl]-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55724763) has the molecular formula C21H31Cl2N3O4S and a molecular weight of 492.47 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(4-methylpiperidin-1-yl)butyl]-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-[4-(4-methylpiperidin-1-yl)butyl]-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55724763 |
| Molecular Formula | C21H31Cl2N3O4S |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2,4-dichloro-N-[4-(4-methylpiperidin-1-yl)butyl]-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC1CCN(CCCCNC(=O)c2cc(S(=O)(=O)N3CCOCC3)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C21H31Cl2N3O4S/c1-16-4-8-25(9-5-16)7-3-2-6-24-21(27)17-14-20(19(23)15-18(17)22)31(28,29)26-10-12-30-13-11-26/h14-16H,2-13H2,1H3,(H,24,27) |
| InChIKey | RCDFEHJVNQHHRH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|