C19H26Cl2N2O6S — CID 154747662
2,4-dichloro-5-morpholin-4-ylsulfonyl-N-[3-(oxolan-2-ylmethoxy)propyl]benzamide (PubChem CID 154747662) has the molecular formula C19H26Cl2N2O6S and a molecular weight of 481.40 g/mol. Its IUPAC name is 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-[3-(oxolan-2-ylmethoxy)propyl]benzamide.
| Compound Name | 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-[3-(oxolan-2-ylmethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 154747662 |
| Molecular Formula | C19H26Cl2N2O6S |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2,4-dichloro-5-morpholin-4-ylsulfonyl-N-[3-(oxolan-2-ylmethoxy)propyl]benzamide |
| SMILES | O=C(NCCCOCC1CCCO1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H26Cl2N2O6S/c20-16-12-17(21)18(30(25,26)23-5-9-27-10-6-23)11-15(16)19(24)22-4-2-7-28-13-14-3-1-8-29-14/h11-12,14H,1-10,13H2,(H,22,24) |
| InChIKey | GEPTZFQJADKSNF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|