C16H21ClN2O5S — CID 34551600
3-chloro-4-morpholin-4-ylsulfonyl-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 34551600) has the molecular formula C16H21ClN2O5S and a molecular weight of 388.87 g/mol. Its IUPAC name is 3-chloro-4-morpholin-4-ylsulfonyl-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-chloro-4-morpholin-4-ylsulfonyl-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 34551600 |
| Molecular Formula | C16H21ClN2O5S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 3-chloro-4-morpholin-4-ylsulfonyl-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccc(S(=O)(=O)N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O5S/c17-14-10-12(16(20)18-11-13-2-1-7-24-13)3-4-15(14)25(21,22)19-5-8-23-9-6-19/h3-4,10,13H,1-2,5-9,11H2,(H,18,20)/t13-/m0/s1 |
| InChIKey | FQADEGHXHHQXFY-ZDUSSCGKSA-N |
| XLogP | 1.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |