C20H29N3O5S — CID 25361107
5-morpholin-4-ylsulfonyl-N-[[(2R)-oxolan-2-yl]methyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 25361107) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is 5-morpholin-4-ylsulfonyl-N-[[(2R)-oxolan-2-yl]methyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-morpholin-4-ylsulfonyl-N-[[(2R)-oxolan-2-yl]methyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 25361107 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-morpholin-4-ylsulfonyl-N-[[(2R)-oxolan-2-yl]methyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NC[C@H]1CCCO1)c1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C20H29N3O5S/c24-20(21-15-16-4-3-11-28-16)18-14-17(5-6-19(18)22-7-1-2-8-22)29(25,26)23-9-12-27-13-10-23/h5-6,14,16H,1-4,7-13,15H2,(H,21,24)/t16-/m1/s1 |
| InChIKey | BZYIIPDZDANAAF-MRXNPFEDSA-N |
| XLogP | 1.22 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |