C20H30N4O4S2 — CID 41152617
1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 41152617) has the molecular formula C20H30N4O4S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 41152617 |
| Molecular Formula | C20H30N4O4S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | O=S(=O)(c1ccc(N2CCCC2)c(NC(=S)NC[C@@H]2CCCO2)c1)N1CCOCC1 |
| InChI | InChI=1S/C20H30N4O4S2/c25-30(26,24-9-12-27-13-10-24)17-5-6-19(23-7-1-2-8-23)18(14-17)22-20(29)21-15-16-4-3-11-28-16/h5-6,14,16H,1-4,7-13,15H2,(H2,21,22,29)/t16-/m0/s1 |
| InChIKey | FWNNAZUHKNRFII-INIZCTEOSA-N |
| XLogP | 1.77 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|