C17H26N4O3S2 — CID 4829989
1-ethyl-3-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)thiourea (PubChem CID 4829989) has the molecular formula C17H26N4O3S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-ethyl-3-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)thiourea.
| Compound Name | 1-ethyl-3-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)thiourea |
|---|---|
| PubChem CID | 4829989 |
| Molecular Formula | C17H26N4O3S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-ethyl-3-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)thiourea |
| SMILES | CCNC(=S)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C17H26N4O3S2/c1-2-18-17(25)19-15-13-14(5-6-16(15)20-7-3-4-8-20)26(22,23)21-9-11-24-12-10-21/h5-6,13H,2-4,7-12H2,1H3,(H2,18,19,25) |
| InChIKey | PLVGFBRFPHTKIB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|