C22H27FN4O3S2 — CID 24501806
1-(3-fluoro-4-methylphenyl)-3-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)thiourea (PubChem CID 24501806) has the molecular formula C22H27FN4O3S2 and a molecular weight of 478.62 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)thiourea.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)thiourea |
|---|---|
| PubChem CID | 24501806 |
| Molecular Formula | C22H27FN4O3S2 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2N2CCCC2)cc1F |
| InChI | InChI=1S/C22H27FN4O3S2/c1-16-4-5-17(14-19(16)23)24-22(31)25-20-15-18(6-7-21(20)26-8-2-3-9-26)32(28,29)27-10-12-30-13-11-27/h4-7,14-15H,2-3,8-13H2,1H3,(H2,24,25,31) |
| InChIKey | HHCHBSDQYYLOCT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|