C17H17F2N3O3S2 — CID 17271641
1-(2,5-difluorophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 17271641) has the molecular formula C17H17F2N3O3S2 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(2,5-difluorophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 17271641 |
| Molecular Formula | C17H17F2N3O3S2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)Nc2cc(F)ccc2F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H17F2N3O3S2/c18-12-1-6-15(19)16(11-12)21-17(26)20-13-2-4-14(5-3-13)27(23,24)22-7-9-25-10-8-22/h1-6,11H,7-10H2,(H2,20,21,26) |
| InChIKey | KHEKIEHXTHMEBX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|