C18H20FN3O4S2 — CID 23884042
1-(4-fluorophenyl)-3-(4-methoxy-2-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 23884042) has the molecular formula C18H20FN3O4S2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(4-methoxy-2-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-(4-methoxy-2-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 23884042 |
| Molecular Formula | C18H20FN3O4S2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(4-methoxy-2-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(F)cc2)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H20FN3O4S2/c1-25-15-6-7-16(21-18(27)20-14-4-2-13(19)3-5-14)17(12-15)28(23,24)22-8-10-26-11-9-22/h2-7,12H,8-11H2,1H3,(H2,20,21,27) |
| InChIKey | IXJBOIHLNLWNFB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|