C19H22N4O5S2 — CID 1176488
1-(4-methoxyphenyl)-3-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiourea (PubChem CID 1176488) has the molecular formula C19H22N4O5S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 1176488 |
| Molecular Formula | C19H22N4O5S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C19H22N4O5S2/c1-27-16-6-4-15(5-7-16)20-19(29)22-21-18(24)14-2-8-17(9-3-14)30(25,26)23-10-12-28-13-11-23/h2-9H,10-13H2,1H3,(H,21,24)(H2,20,22,29) |
| InChIKey | ACFMJXAWJLAZCV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|