C19H23N3O5S2 — CID 2488318
1-(2-methoxy-4-morpholin-4-ylsulfonylphenyl)-3-(4-methoxyphenyl)thiourea (PubChem CID 2488318) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(2-methoxy-4-morpholin-4-ylsulfonylphenyl)-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-(2-methoxy-4-morpholin-4-ylsulfonylphenyl)-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2488318 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-(2-methoxy-4-morpholin-4-ylsulfonylphenyl)-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2OC)cc1 |
| InChI | InChI=1S/C19H23N3O5S2/c1-25-15-5-3-14(4-6-15)20-19(28)21-17-8-7-16(13-18(17)26-2)29(23,24)22-9-11-27-12-10-22/h3-8,13H,9-12H2,1-2H3,(H2,20,21,28) |
| InChIKey | KGJFSGUYFROLBJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|