C21H20ClN3O4S2 — CID 25047087
1-(4-chlorophenyl)-3-[2-methoxy-4-[(4-methoxyphenyl)sulfamoyl]phenyl]thiourea (PubChem CID 25047087) has the molecular formula C21H20ClN3O4S2 and a molecular weight of 478.00 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-methoxy-4-[(4-methoxyphenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-methoxy-4-[(4-methoxyphenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 25047087 |
| Molecular Formula | C21H20ClN3O4S2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-methoxy-4-[(4-methoxyphenyl)sulfamoyl]phenyl]thiourea |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=S)Nc3ccc(Cl)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H20ClN3O4S2/c1-28-17-9-7-16(8-10-17)25-31(26,27)18-11-12-19(20(13-18)29-2)24-21(30)23-15-5-3-14(22)4-6-15/h3-13,25H,1-2H3,(H2,23,24,30) |
| InChIKey | QTZJVKRVTBOQKT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|