C24H27N3O4S2 — CID 25043502
1-[4-methoxy-2-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 25043502) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 1-[4-methoxy-2-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[4-methoxy-2-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 25043502 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 1-[4-methoxy-2-[(4-methoxyphenyl)sulfamoyl]phenyl]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(OC)ccc2NC(=S)Nc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-16(2)17-5-7-18(8-6-17)25-24(32)26-22-14-13-21(31-4)15-23(22)33(28,29)27-19-9-11-20(30-3)12-10-19/h5-16,27H,1-4H3,(H2,25,26,32) |
| InChIKey | MIGXLYPEQAVICC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|