C26H22IN3O3S2 — CID 25047088
1-[2-[(4-iodophenyl)sulfamoyl]-4-methylphenyl]-3-(4-phenoxyphenyl)thiourea (PubChem CID 25047088) has the molecular formula C26H22IN3O3S2 and a molecular weight of 615.52 g/mol. Its IUPAC name is 1-[2-[(4-iodophenyl)sulfamoyl]-4-methylphenyl]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-[2-[(4-iodophenyl)sulfamoyl]-4-methylphenyl]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 25047088 |
| Molecular Formula | C26H22IN3O3S2 |
| Molecular Weight | 615.52 g/mol |
| Exact Mass | 615.01 |
| IUPAC Name | 1-[2-[(4-iodophenyl)sulfamoyl]-4-methylphenyl]-3-(4-phenoxyphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(Oc3ccccc3)cc2)c(S(=O)(=O)Nc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C26H22IN3O3S2/c1-18-7-16-24(25(17-18)35(31,32)30-21-10-8-19(27)9-11-21)29-26(34)28-20-12-14-23(15-13-20)33-22-5-3-2-4-6-22/h2-17,30H,1H3,(H2,28,29,34) |
| InChIKey | BYMSXTFTDDCEQE-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|