C22H23N3O4S2 — CID 25047925
1-benzyl-3-[4-methoxy-2-[(4-methoxyphenyl)sulfamoyl]phenyl]thiourea (PubChem CID 25047925) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 1-benzyl-3-[4-methoxy-2-[(4-methoxyphenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-benzyl-3-[4-methoxy-2-[(4-methoxyphenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 25047925 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 1-benzyl-3-[4-methoxy-2-[(4-methoxyphenyl)sulfamoyl]phenyl]thiourea |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(OC)ccc2NC(=S)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N3O4S2/c1-28-18-10-8-17(9-11-18)25-31(26,27)21-14-19(29-2)12-13-20(21)24-22(30)23-15-16-6-4-3-5-7-16/h3-14,25H,15H2,1-2H3,(H2,23,24,30) |
| InChIKey | SGRPIUZBHUVFIZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|