C20H24ClN3O3S2 — CID 25046526
1-[2-[(4-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-3-cyclohexylthiourea (PubChem CID 25046526) has the molecular formula C20H24ClN3O3S2 and a molecular weight of 454.02 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-3-cyclohexylthiourea.
| Compound Name | 1-[2-[(4-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 25046526 |
| Molecular Formula | C20H24ClN3O3S2 |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)sulfamoyl]-4-methoxyphenyl]-3-cyclohexylthiourea |
| SMILES | COc1ccc(NC(=S)NC2CCCCC2)c(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H24ClN3O3S2/c1-27-17-11-12-18(23-20(28)22-15-5-3-2-4-6-15)19(13-17)29(25,26)24-16-9-7-14(21)8-10-16/h7-13,15,24H,2-6H2,1H3,(H2,22,23,28) |
| InChIKey | XBGLTDQIFZESQV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|