C23H25N3O5S2 — CID 25035110
1-[2-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 25035110) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-[2-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 25035110 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 1-[2-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(OC)ccc2NC(=S)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O5S2/c1-4-31-19-11-7-17(8-12-19)26-33(27,28)22-15-20(30-3)13-14-21(22)25-23(32)24-16-5-9-18(29-2)10-6-16/h5-15,26H,4H2,1-3H3,(H2,24,25,32) |
| InChIKey | XLCFQZBIJFDFNW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|