C24H27N3O4S2 — CID 25039010
1-(2,4-dimethylphenyl)-3-[2-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]thiourea (PubChem CID 25039010) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[2-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[2-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]thiourea |
|---|---|
| PubChem CID | 25039010 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[2-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]thiourea |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(OC)ccc2NC(=S)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-5-31-19-9-7-18(8-10-19)27-33(28,29)23-15-20(30-4)11-13-22(23)26-24(32)25-21-12-6-16(2)14-17(21)3/h6-15,27H,5H2,1-4H3,(H2,25,26,32) |
| InChIKey | QMDIEYTUWMOADB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|