C24H26N2O2S — CID 43077065
1-[(4-methoxyphenyl)methyl]-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea (PubChem CID 43077065) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 43077065 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[[4-(phenylmethoxymethyl)phenyl]methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NCc2ccc(COCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-27-23-13-11-20(12-14-23)16-26-24(29)25-15-19-7-9-22(10-8-19)18-28-17-21-5-3-2-4-6-21/h2-14H,15-18H2,1H3,(H2,25,26,29) |
| InChIKey | WYEOQQNCRJYXRD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|