C22H22N2OS — CID 8618623
1-benzhydryl-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 8618623) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-benzhydryl-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-benzhydryl-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8618623 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-benzhydryl-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2OS/c1-25-20-14-12-17(13-15-20)16-23-22(26)24-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,21H,16H2,1H3,(H2,23,24,26) |
| InChIKey | ZQZJQVOZEUUBCL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|